On Target 5HT4R_HUMAN 0.47953215/CHEMBL2401750
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.47953215, the most similar ligand is CHEMBL2401750. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL2401750 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | CC(C)c1nc2c(cccc2[nH]1)C(=O)NCC3CCN(CC4CCN(CC4)C(=O)C)CC3 |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 1000000a 01001800 00100500 10050610 00040060 00004000 00004000 22001004 00200100 000008d0 41208004 50838000 00008882 00408000 000204c0 020c0004 00020008 02000000 00200000 40000201 c0000000 18068e20 21800000 0050011c 00044000 c0000000 00000040 90000000 00000104 00460801 e0048000 a00022a0 |