On Target V1AR_HUMAN 0/CHEMBL373742
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL373742. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL373742 (Similar Ligand) |
|---|---|
| C | N[C@H]1CSSC[C@H](NC(=O)[C@H](CC(=O)N)NC(=O)[C@H](CCC(=O)N)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](Cc3ccc(O)cc3)NC1=O)C(=O)N4CCC[C@H]4C(=O)N[C@@H](CCCNC(=N)N)C(=O)NCC(=O)N |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00030000 81003618 60100100 44110f00 00000000 00000110 02000000 2000200c 00200a80 020f09c2 08300000 4003b000 0e009016 00042001 80000000 00140008 00000000 02000001 00000018 004e2301 40000140 382d0620 00000603 87500018 00001800 80800000 40120400 10000000 0c000012 0006803b a0084000 03c12600 |