On Target CCR4_HUMAN 0/CHEMBL42774
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL42774. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL42774 (Similar Ligand) |
|---|---|
| C | Clc1ccc([C@H]2S[C@H](CC(=O)NCc3cccc4ccccc34)C(=O)N2CC(=O)N5CCC(CC5)N6CCCC6)c(Cl)c1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00028002 41803400 20166708 0c310640 20010000 00002030 80200000 22001008 00600000 0a0549e0 00201801 5007b800 0601f846 400c2400 80000400 00400000 04000418 02000300 00000000 00401209 c0100800 380c870e 00000301 06500018 00442200 c0000220 00044000 90000150 08000102 00060031 28044010 83832280 |