On Target 5HT1D_HUMAN 0/CHEMBL294547
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL294547. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL294547 (Similar Ligand) |
|---|---|
| C | C(CN1CCC(Cc2ccccc2)CC1)Cc3c[nH]c4ccc(cc34)n5cnnc5 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000002 01800a08 40100102 40810610 00041240 00000004 00042000 20001000 00500900 000808c0 08300004 50018000 88000802 00600800 00040040 000c000c 08008000 0200000c 00600400 00240201 40000100 18008008 21800000 80500010 00042000 80000000 08000080 10000000 00000000 0006000a 80040200 00202620 |