On Target OPRM_HUMAN 0/CHEMBL247760
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL247760. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL247760 (Similar Ligand) |
|---|---|
| C | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@H](CO)NC(=O)[C@@H](N)Cc2c(C)cc(cc2C)C(=O)N)C(=O)N[C@@H]([C@@H](C)O)C(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00010000 01007a00 00100100 44010600 000000a1 00000000 01000000 2000100c 00000980 000808c0 08300000 4001b800 96008802 00202001 80180000 0a0c0008 10000000 02000000 01c00008 00000201 00000100 38268e00 03004083 8350001c 00000801 80000001 08000000 10000000 0c000000 0006000b a0044000 00002600 |