On Target MC4R_HUMAN 0/CHEMBL1269572
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL1269572. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL1269572 (Similar Ligand) |
|---|---|
| C | Cc1cc2C(CC3(CCN(CC3)C(=O)[C@@H]4CN(C[C@H]4c5ccc(F)cc5F)C(C)(C)C)c2cc1Cl)C(C)(C)c6cnn[nH]6 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 02028000 47001618 20300103 02810610 00000701 40000012 04002000 20040201 00200980 100909e0 08308000 d0039840 0e0082a6 00203200 80810000 020e200c 41000200 06008080 00002018 00140201 00120104 18340710 01404000 89540018 00003800 80000201 00040000 10002081 04000006 0006c01b 00020000 04822700 |