On Target TAAR1_HUMAN 0/CHEMBL2206889
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL2206889. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL2206889 (Similar Ligand) |
|---|---|
| C | CC(C)N(Cc1c[nH]cn1)c2ccccc2Cl |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 1000c002 00200000 00000002 00001e10 00020040 00100000 00004000 08003001 00000100 00000840 40218004 40008800 02000006 00100000 00020440 000c0004 00060000 02000002 88000000 40000000 40100000 08000900 21010000 00010010 00042000 00000401 00000000 80000080 00008004 00460000 40000000 80020200 |