On Target DRD2_HUMAN 0/CHEMBL1277917
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL1277917. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL1277917 (Similar Ligand) |
|---|---|
| C | CN1CCN(CC1)c2ccc3[nH]nc(c3c2)S(=O)(=O)c4ccccc4 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00004082 00802308 20020020 04900600 00040000 00000000 02020000 00000008 00000000 00000a40 00202004 70008000 10000002 00402000 80200040 0004000c 04041008 00000008 08600410 00226484 d0100800 2c201008 20800820 1a20001b 00100000 08000000 00000000 048000c0 08008200 00060000 08000000 00014264 |