On Target HRH3_HUMAN 0/CHEMBL1257850
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL1257850. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL1257850 (Similar Ligand) |
|---|---|
| C | CC(C)N1CCC(CC1)Oc2ccc3c(c2)cc4C(=O)N[C@@H](C)Cn34 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 04000002 0100bc08 20100108 50010e00 00041020 02100000 06080000 22003001 00200000 000108c0 00290004 50018000 00809806 00500000 01020c41 020c210c 00204000 02000006 00a00000 00020201 40000001 382f8618 21802080 8250001c 08102001 c0000000 00400000 90000000 08000304 00060051 800c0200 00004240 |