On Target OPRK_HUMAN 0/CHEMBL1257346
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL1257346. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL1257346 (Similar Ligand) |
|---|---|
| C | O=C(Nc1cccc(NC(=O)c2cccc(c2)N3CCOCC3)c1)c4cccc(OC5CCN(CC6CC6)CC5)c4 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 14004002 45000808 60101108 80010600 08001080 0a000000 02000800 22001000 00800000 000008d0 002c0004 5001c000 00808802 01100080 01005049 30082108 10240000 02000000 08880000 00020201 40100000 18028600 33012080 00548014 000c0401 80100000 08000400 90000080 20c08300 00060001 80040000 00002240 |