On Target ADA2B_HUMAN 0/CHEMBL1276140
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL1276140. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL1276140 (Similar Ligand) |
|---|---|
| C | C[C@H](Oc1ccccc1CC=C)C2=NCCN2 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 04002000 00000008 20300108 00012602 00001080 80810000 12000009 00000600 01050000 20180843 18210010 60008000 00900002 00000008 01101001 00182008 10000800 22128000 00000020 00020200 00200000 38040000 12000001 02400810 00200080 c0000000 40000000 00000001 08040310 00068002 04000000 00000600 |