On Target ACM1_HUMAN 0/CHEMBL3085072
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL3085072. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL3085072 (Similar Ligand) |
|---|---|
| C | [Br-].C[N+]1(C)[C@@H]2CC[C@H]1C[C@@H](C2)OC(=O)N(Cc3ccccc3)c4ccsc4 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00010002 01c00800 00100100 81010700 00080000 00000010 80000009 a2001100 00000204 000018c0 00a80300 d001c080 00108812 00900102 0000000a 009a0008 00a68000 02800000 10c02800 00400201 80100000 58088c90 21010080 0050001c 00000001 84201002 00000000 90201084 00000300 a0060007 80060008 00c12200 |