On Target 5HT1F_HUMAN 0/CHEMBL445651
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL445651. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL445651 (Similar Ligand) |
|---|---|
| C | CN1CCC(CC1)c2noc3ccc(NC(=O)c4ccc(F)cc4)cc23 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00004082 01000a00 001a0100 62014600 00040200 00100010 00000020 22001000 04020800 000808c0 08388044 7021c000 0000a802 00509040 00200040 20040004 01040200 0603010a 08200000 00900205 40902104 18038608 20c12000 00580094 00000000 80010000 00000030 98000181 00208104 0106820b 80040000 c0000610 |