On Target GRM5_HUMAN 0/CHEMBL387976
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL387976. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL387976 (Similar Ligand) |
|---|---|
| C | CCCCC1=Nc2c(sc3nccc(N(C)C)c23)C(=O)N1c4ccc(CC)cc4 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 0003001a 31800a00 00005118 50094610 001c0060 0000c860 01089802 10009108 36500100 400818e0 0920ca0c d0838080 80109831 02e00200 080620c0 020c0c0c 28040008 26008090 08600018 00c10001 40000080 588c80f8 218000c1 83700410 00004001 cc080048 60008080 00040084 0400c804 00c6100a 40258000 60c10ec0 |