On Target NPBW1_HUMAN 0/CHEMBL1972527
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL1972527. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL1972527 (Similar Ligand) |
|---|---|
| C | COc1ccc(OC2=C(Cl)C=NN(C3c4ccccc4c5ccccc35)C2=O)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00012004 00000609 60000108 90010600 00081078 00008008 42048400 01001000 16100000 900808c0 08002008 78858800 0600980e 02e00000 21040001 030d200c 08060008 02004028 04202110 40660000 00400000 3c018318 31804891 83700010 04907040 a0008c00 00088000 40240040 06004280 00060c0a 80040400 42c20400 |