On Target ACM3_HUMAN 0/CHEMBL221829
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL221829. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL221829 (Similar Ligand) |
|---|---|
| C | Nc1cccc(CN2CCC(CC2)N3CC(NC3=O)(c4ccccc4)c5ccccc5)c1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 10000002 01803400 00100100 04010e00 00000000 00000000 00000004 2300300c 00800080 000809e0 09200004 50018000 00009802 00002000 00000440 00000000 00004008 02002000 00000040 00000201 c0000100 38298400 20000001 83500018 00050000 e0000000 00000000 d0000000 0c400180 00060013 20140000 80002600 |