On Target DRD5_HUMAN 0/CHEMBL209497
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL209497. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL209497 (Similar Ligand) |
|---|---|
| C | FC(F)(F)c1cccc(c1)\N=C/2\C(=O)N(c3cccc(OCCN4CCCC4)c3)c5ccccc25 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 04006006 80040008 20124108 08810602 30001082 04000052 12000410 20060040 02102100 000808d1 082a0004 40009414 01808002 49108000 410a11c1 00180008 10058880 02000020 08000002 00022e01 40100400 18240600 b3002000 81400011 000c0000 88000300 42000418 91001081 04489218 00260003 40902001 20020600 |