On Target TSHR_HUMAN 0/CHEMBL1705547
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL1705547. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL1705547 (Similar Ligand) |
|---|---|
| C | COc1ccc(cc1COc2ccc(NC(=O)C)cc2)C3Nc4ccc(O)cc4C(=O)N3Cc5ccccc5 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 14004006 44800808 20000108 00010e00 00001001 40114042 12040004 02003809 00800100 20000840 41280004 4000c000 00808822 00110000 01020441 22082008 00046800 03400022 08000000 40820a01 c0100100 08038620 20032000 00c4101c 00100000 c0002000 08260000 80001080 00008300 00060001 c0044004 c0004201 |