On Target 5HT1B_HUMAN 0/CHEMBL351346
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL351346. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL351346 (Similar Ligand) |
|---|---|
| C | CC(N1CCN(CCCc2c[nH]c3ccc(cc23)n4cnnc4)CC1)c5ccccc5 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000002 00800a08 40100100 44810610 00041240 00000004 00042000 22001000 00400900 000908c0 08300004 40008000 88000802 00402800 00040440 000c000c 08008000 0200000c 00600400 00240201 40000100 38008008 21800021 82400010 00042000 c0000000 08000080 90000000 08000100 0006000a 80040200 00200620 |