On Target OPRD_HUMAN 0/CHEMBL246572
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL246572. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL246572 (Similar Ligand) |
|---|---|
| C | CSCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@@H](N)Cc2ccc3nc(N)sc3c2)C(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00030002 10007200 00100108 84110640 000c0080 0200a000 00000100 2002800c 84400880 000858c0 08300a04 5008b000 0601802a 00c42001 801830c0 000c040c 14081000 0200008c 00600018 00200201 40000100 7c200e80 23800b03 83610018 00004800 8c000000 40000000 10000004 0c400008 0006202b 2001c000 01412600 |