On Target CNR2_HUMAN 0/CHEMBL1269973
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL1269973. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL1269973 (Similar Ligand) |
|---|---|
| C | C[C@@H]1CN(CC[C@@H]1CNS(=O)(=O)C(F)(F)F)S(=O)(=O)c2cc3ccccc3n2S(=O)(=O)c4ccccc4F |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000012 03880000 29102052 03b40640 200c0040 10404110 40000000 20100000 0020a000 004008c0 00202004 70038000 01001902 00641003 84600041 00460804 04002000 00000100 00600020 01026601 c0800000 18008808 20800050 98500098 03850000 90000104 20040020 9040000f 00004400 22068820 00040200 41012270 |