On Target ACM2_HUMAN 0/CHEMBL1223803
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL1223803. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL1223803 (Similar Ligand) |
|---|---|
| C | CCCO[C@@H]1CC[C@](C)(CC1)N2CCC(CC2)N3C(=O)Cc4ccc(C)cc34 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00004042 01001400 40100100 00010700 24180000 00000040 00000000 20000000 00000180 000809f0 08280004 50019800 01008002 00900000 40020140 0008100a 00848000 02000000 0a402000 00000201 60100420 18280610 21002000 81500019 00040400 80000200 00000210 10001080 04488200 00060013 00022000 20002e00 |