On Target 5HT2C_HUMAN 0/CHEMBL1222232
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL1222232. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL1222232 (Similar Ligand) |
|---|---|
| C | CC(C)N(C(=O)c1cccc2ccccc12)c3cccc(c3)N4CCN(C)CC4 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00004002 00000800 00000120 04010600 08000000 00000000 00000800 02001000 00000000 00000a40 00280004 4000c000 00008802 00102000 00000440 00000000 00040000 02000000 08000000 00000000 40100000 28028608 20012020 0240001e 00080000 c0100000 00000400 80000080 08808100 00060001 80040000 00000200 |