On Target 5HT7R_HUMAN 0/CHEMBL347286
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL347286. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL347286 (Similar Ligand) |
|---|---|
| C | CC1CCN(CC[C@@H]2CCCN2S(=O)(=O)c3cccc(Br)c3)CC1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00004010 01808400 01100000 01b00600 00480000 00000010 00000000 20000100 00000000 004009e0 00202200 70018000 00000012 00000001 80e00000 00000000 00002000 00000000 00402000 00007603 80000000 18000018 00000000 18500018 02000000 0040000c 00020000 1000000c 00000400 20060010 00000008 08012270 |