On Target AA2BR_HUMAN 0.28333333/CHEMBL2113345
For the given ligand Ibuprofen, we have found in our database that, being scored 0.28333333, the most similar ligand is CHEMBL2113345. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL2113345 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | CCCCN1C(=O)Nc2nc([nH]c2C1=O)c3ccc(CC(=O)O)cc3 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 0000802a 00801800 00180100 12010600 00080060 0000c040 00009000 00080400 16400100 900818e0 0c00800c 40019800 03009000 00d01000 402e0080 080c000c 08000000 0200a000 00400000 00400001 80000100 38000a50 21802041 00700014 00040000 c0200000 60000000 00040000 00004004 00460c02 c0082800 40000680 |