On Target OPRM_HUMAN 0.4857143/CHEMBL607
For the given ligand Ibuprofen, we have found in our database that, being scored 0.4857143, the most similar ligand is CHEMBL607. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL607 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | CCOC(=O)C1(CCN(C)CC1)c2ccccc2 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 |