On Target CCR5_HUMAN 0.4556962/CHEMBL100336
For the given ligand Ibuprofen, we have found in our database that, being scored 0.4556962, the most similar ligand is CHEMBL100336. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL100336 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | OC(=O)Cc1ccc(CCCC2(O)CCN(C[C@H]3CN(CC4CCCCC4)C[C@@H]3c5ccccc5)CC2)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00000000 01000600 00100102 00010600 00080040 00000010 00000000 20000000 00200980 000809e0 08300000 50039800 01008002 00200000 40040000 000c0008 08000000 02000000 02c02000 00000201 00000100 18200a10 01000080 81500010 00000001 80000000 00000000 10000000 04000002 0006001a 00022000 00002600 |