On Target MC4R_HUMAN 0.33333334/CHEMBL371896
For the given ligand Ibuprofen, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL371896. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL371896 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | CCN(CC)CC(Cc1ccccc1)N2CCN(C)CC2 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00000000 00000200 00100100 04010600 00000000 00000000 00000000 20000000 00000880 000808c0 08300000 40008000 00000002 00002000 00000000 00040000 00000000 02000000 00000000 00000201 00000100 38200000 00000023 83400010 00000000 80000000 00000000 10000000 0c000000 0006000a 00000000 00000600 |