On Target ADA1D_HUMAN 0.42352942/CHEMBL41677
For the given ligand Ibuprofen, we have found in our database that, being scored 0.42352942, the most similar ligand is CHEMBL41677. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL41677 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | COC(=O)C1(CCN(CCCNC(=O)C(c2ccc(C)cc2)c3ccc(C)cc3)CC1)c4ccccc4 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00020000 01001600 00100100 00010700 00100040 00000000 00000000 21000040 00000980 000809e0 08300000 50019800 05008002 00000000 40040000 000c0008 08020000 02000000 04400000 00000201 00000100 18280e00 01000000 81500018 00000000 a0000000 00000200 50000000 04000280 0006001b 00002000 00802e00 |