On Target HRH3_HUMAN 0.515625/CHEMBL3427233
For the given ligand Ibuprofen, we have found in our database that, being scored 0.515625, the most similar ligand is CHEMBL3427233. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL3427233 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | C[C@@H]1CCCN1CCc2ccc(cc2)c3ccc(cc3)C(C)(C)C(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00002000 01000000 00100100 00010600 00000040 00000010 00000000 20000000 00000180 000808c0 08200000 40019800 01008002 00000000 40040000 00080008 08020000 02000000 04000000 10000201 00000000 18200a00 11000000 81500010 00000000 80000000 00000000 10000040 04004000 00060002 00002000 00002600 |