On Target CXCR3_HUMAN 0.2990654/CHEMBL458422
For the given ligand Ibuprofen, we have found in our database that, being scored 0.2990654, the most similar ligand is CHEMBL458422. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL458422 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | OC(=O)c1cccc(c1)C2(CCC(=O)NC2=O)C3CCN(Cc4ccc(Br)cc4)CC3 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00014000 01009800 00100102 00010600 00001001 00004000 00000000 22001004 00100980 000a0ac0 28300000 50019000 0500881a 00200000 40000400 08080008 00000000 02000800 00002000 40000201 00020100 18268e30 01000000 8150001c 00000000 c0000000 00120000 90004000 04000100 00060003 e0062008 08402600 |