On Target CNR1_HUMAN 0.516129/CHEMBL391380
For the given ligand Ibuprofen, we have found in our database that, being scored 0.516129, the most similar ligand is CHEMBL391380. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL391380 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | COC(=O)C(C)(C)c1ccc(c(O)c1)c2cc(C)cc(C)c2 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00002000 42000008 20000100 00010200 00000041 00000000 02000000 00000040 00000100 00080840 08000000 40009800 01408002 00000000 40040000 00082008 08020000 02001000 04000000 10020200 00000000 08000a00 11000000 00404010 00000000 80000000 10000000 00010041 00004200 00020002 00002200 00000400 |