On Target 5HT1F_HUMAN 0.24299066/CHEMBL318110
For the given ligand Ibuprofen, we have found in our database that, being scored 0.24299066, the most similar ligand is CHEMBL318110. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL318110 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | CN1CCC(CC1)c2c[nH]c3ccc(O)nc23 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00000002 03800a18 20104101 40810610 000c1240 00000000 0600a000 20000000 00400800 000800c0 08300004 50018000 08000806 00400800 60040300 0004000c 08000000 02000000 00600400 00020201 40020100 18008008 21800040 80500010 00042000 80000000 08008000 10002004 00000000 0006000a 00040200 04000620 |