On Target GRM5_HUMAN 0.42647058/CHEMBL1682794
For the given ligand Ibuprofen, we have found in our database that, being scored 0.42647058, the most similar ligand is CHEMBL1682794. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL1682794 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | O=C1CCc2cc(ccc12)C#Cc3ccccc3 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 10000200 01020800 00000902 40090200 00402001 00008000 00000000 00000000 00000900 00080840 08110000 40009800 04008000 00201000 00000000 000a0008 00000000 02000000 00000008 00000011 00000100 08820240 01004001 02400014 00000804 80040000 00008000 00000000 00000000 00020002 80000000 00000400 |