On Target NPBW1_HUMAN 0.20945945/CHEMBL2314288
For the given ligand Ibuprofen, we have found in our database that, being scored 0.20945945, the most similar ligand is CHEMBL2314288. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL2314288 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | COc1ccc(OC2=C(Cl)C=NN(CC(=O)C(c3ccccc3)c4ccccc4)C2=O)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00010004 00000608 60000108 00010600 00081018 0000a048 46040000 01000000 06100800 800808c0 08142008 7885b800 0700900e 02e00000 41000081 050d200c 00040000 c2000028 00602110 40260001 80400100 1c010318 21800881 02700012 04105040 a0008c00 00080008 40200000 00001280 0006000a 80082400 02c20400 |