On Target DRD1_HUMAN 0.3452381/CHEMBL305660
For the given ligand Ibuprofen, we have found in our database that, being scored 0.3452381, the most similar ligand is CHEMBL305660. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL305660 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | CC(C)(C)c1ccc(cc1)C(=O)CCCN2CCC(CC2)OC(c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00020000 01000800 00100102 40010600 00000010 00004000 00000000 21000000 00100900 000808c0 08300000 50019800 04008002 00290000 00000000 02080008 00200000 02000000 00800000 00000201 00000120 18020220 01000080 00500014 00000401 a0002000 00080000 50000000 00000280 00060002 c0000000 02802600 |