On Target DRD5_HUMAN 0.32954547/CHEMBL54
For the given ligand Ibuprofen, we have found in our database that, being scored 0.32954547, the most similar ligand is CHEMBL54. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL54 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | OC1(CCN(CCCC(=O)c2ccc(F)cc2)CC1)c3ccc(Cl)cc3 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00028000 01000a00 00100102 02010600 00000000 00004010 00000000 20000000 00100900 000808c0 08300000 50019800 060080a6 00201000 00200000 000c0008 00000000 02000080 00800000 00100201 00000100 18020320 01000080 00500014 00002001 80000000 00040000 10000001 00000000 0006800a c0000000 00822600 |