On Target OPRD_HUMAN 0.3846154/CHEMBL201038
For the given ligand Ibuprofen, we have found in our database that, being scored 0.3846154, the most similar ligand is CHEMBL201038. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL201038 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | OC(C(=O)O)c1ccccc1.Oc2ccc3C[C@H]4C5CCCC[C@@]5(CCN4CC6CC6)c3c2 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00000000 43000208 20100102 00010600 00000060 40004002 02000000 20000001 00000980 000808c0 08300000 5081d000 01008002 01200000 40040020 020c0008 08000200 02000000 02002000 00020201 00000100 18200a30 05004000 81500010 00000000 80000001 00120000 10000000 04000002 0006000a 40022000 00002600 |