On Target CNR2_HUMAN 0.5531915/CHEMBL264412
For the given ligand Ibuprofen, we have found in our database that, being scored 0.5531915, the most similar ligand is CHEMBL264412. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL264412 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | CCCCC(C)(C)c1ccc(cc1)[C@@H]2C[C@H](O)CC[C@H]2CCCO |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00000000 01000000 00000102 00010200 00080000 00000000 00000000 00000000 00000900 00080840 08100000 40008800 00000000 00a00000 00000000 00080008 00000000 02000000 02402000 00000001 00000100 08000000 01000040 00400010 00000000 80000000 00000000 00000000 00000002 00020002 00020000 00000400 |