On Target OPRX_HUMAN 0.41860464/CHEMBL186300
For the given ligand Ibuprofen, we have found in our database that, being scored 0.41860464, the most similar ligand is CHEMBL186300. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL186300 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | COC(=O)C(CCN1CCC(O)(CC1)c2ccc(Cl)cc2)(c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00028000 01000200 00100100 00010700 00100040 00004000 00000000 21000040 00000900 000808c0 08300000 50019800 070080a6 00000000 40040000 000c0008 08020000 02000000 04c00000 00000201 00000100 18000b20 01000080 00500010 00002001 a0000000 00040200 50000000 00000280 0006000a 40002000 00822e00 |