On Target GRM4_HUMAN 0.22137405/CHEMBL3901929
For the given ligand Ibuprofen, we have found in our database that, being scored 0.22137405, the most similar ligand is CHEMBL3901929. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL3901929 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | Clc1cc(Nc2n[nH]c3cccnc23)ccc1C(=O)c4ccccc4 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00008003 00010808 20005100 c0010220 000c0040 08000000 0e800010 01000200 00002100 10080840 88308004 40008810 02008826 00408001 00040040 000c400c 08040000 03001004 08600002 00264000 40080400 0c029b00 21800800 00600014 00122002 a0000200 2a040400 400000c0 00008088 00460002 c4040000 002244e0 |