On Target 5HT7R_HUMAN 0.42105263/CHEMBL443757
For the given ligand Ibuprofen, we have found in our database that, being scored 0.42105263, the most similar ligand is CHEMBL443757. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL443757 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | CCCCC(=O)c1ccc(F)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00010000 01000800 00100102 02010200 00000000 00000010 00000000 00000000 00000800 00080840 08100000 40009000 04008000 00201000 00200000 00000000 00000000 02000080 00002000 00100001 00000100 08020200 00000000 00400014 00000000 80000000 00000000 00000001 00000002 00028002 80000000 00000600 |