On Target 5HT4R_HUMAN 0.25/CHEMBL309655
For the given ligand Ibuprofen, we have found in our database that, being scored 0.25, the most similar ligand is CHEMBL309655. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL309655 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | COc1cc(N)c(Cl)cc1C(=O)CCCN2CCCCC2 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00028002 85000808 2010010a c0010600 00001000 00020000 06000000 20000200 00100800 000808c0 08300004 50019840 06008006 08200000 81000041 00002008 00000000 02000400 00000000 00020601 40000100 18020300 20000000 00540414 00002000 c0000400 00100800 10000000 00000300 00064802 80000000 00822600 |