On Target 5HT1A_HUMAN 0.39130434/CHEMBL3769446
For the given ligand Ibuprofen, we have found in our database that, being scored 0.39130434, the most similar ligand is CHEMBL3769446. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL3769446 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | O[C@@H]1[C@@H](CN2CCC(Cc3ccccc3)CC2)CCC1(c4ccccc4)c5ccccc5 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00000000 01000000 00100102 00010600 00080040 00000000 00000000 21000000 00100800 000808c0 08300000 50018000 00000002 00a00000 00040000 00080008 08000000 02000000 00c02000 00000201 00000100 18000010 01000080 00500010 00000001 a0000000 00000000 50000000 00000082 01060002 00000000 00002600 |