On Target V1AR_HUMAN 0.2509804/CHEMBL389581
For the given ligand test1, we have found in our database that, being scored 0.2509804, the most similar ligand is CHEMBL389581. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL389581 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | CC(C)(C)C(=O)C(N1[C@H](\C=C\c2occc2)[C@H](N3[C@H](COC3=O)c4ccccc4)C1=O)C(=O)OCc5ccccc5 |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 10058000 09e0f820 00180300 84010700 000c00d0 0021d800 80180000 22201448 10804300 805908c8 c8201820 c000b000 5e028c02 00012103 801c142b 021a1008 38864400 02080140 44440810 02801201 80040020 38058e30 13008021 0248001c 81001400 c0043002 14c82010 d8210121 0c400320 80060c03 ec044000 02002600 |