On Target ADRB2_HUMAN 0.33701658/CHEMBL1431082
For the given ligand test1, we have found in our database that, being scored 0.33701658, the most similar ligand is CHEMBL1431082. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL1431082 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | CCOC(=O)c1ccc(NC(=O)Cc2coc3cc4CCCc4cc23)cc1 |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 10004002 01200800 00180102 8009c600 20000211 00004100 00000000 40200200 00024900 00080840 0c380024 40009800 41008400 00319080 40028040 120a0008 00060020 02010000 0a000008 00000001 40104100 1a220e28 20006000 81480015 08000c10 80006000 00080010 0a800090 4400a200 01060003 c0002000 00000600 |