On Target CCR4_HUMAN 0.20661157/CHEMBL64391
For the given ligand test1, we have found in our database that, being scored 0.20661157, the most similar ligand is CHEMBL64391. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL64391 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | CCC(C)N1N=CN(C1=O)c2ccc(cc2)N3CCN(CC3)c4ccc(OCC5COC(Cn6cncn6)(O5)c7ccc(Cl)cc7Cl)cc4 |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 0400c006 00801208 e0000128 84810700 00081050 0200c024 02002802 0000504c 04202100 81080ae0 0820000c 40008900 028088a6 00492400 112410c1 022b200c 08a49000 02080004 19400002 00261001 c01014b8 38048170 27000060 8f600012 10002400 80002220 400c0000 258000a0 0c008200 0006000a c0840000 02220700 |