On Target HRH2_HUMAN 0.25974026/CHEMBL422931
For the given ligand test1, we have found in our database that, being scored 0.25974026, the most similar ligand is CHEMBL422931. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL422931 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | FC(F)(F)c1cc(COCC2(CCNCC2)c3ccccc3)cc(c1)C(F)(F)F |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 00000000 010c0200 00100100 00010700 00100051 00004000 00000400 20000040 00000900 000808d0 08300000 50018002 00000002 01010000 00040000 020c1008 08000000 02000000 04400000 40000201 00010120 18000020 01000000 00400010 00000400 80002000 00080200 90000000 00000200 0006000a 40100004 02000e00 |