On Target CCR5_HUMAN 0.34117648/CHEMBL504250
For the given ligand test1, we have found in our database that, being scored 0.34117648, the most similar ligand is CHEMBL504250. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL504250 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | OCCOC(CCC1CCN(C[C@H]2CN(C[C@@H]2c3cccc(F)c3)[C@H](CC4CC4)C(=O)O)CC1)c5ccc(F)cc5 |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 00010000 01000600 80100102 02010700 00080090 00004010 00000000 20000000 00200980 000829e0 08300000 5003b000 0600800a 01a11000 80080000 020c9008 10800000 02000280 00402000 00100201 00000120 18200a30 07000000 89500010 00000400 80002000 80080000 10000021 04300202 0006801a 40024000 00002600 |