On Target TAAR1_HUMAN 0.26455027/CHEMBL1420390
For the given ligand test1, we have found in our database that, being scored 0.26455027, the most similar ligand is CHEMBL1420390. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL1420390 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | OC(=O)C1C2OC(C=C2)C1C(=O)NCCc3cccc(Cl)c3 |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 00078040 85001000 00100100 00010700 003c0040 00200000 06000000 28000406 10000080 011888c8 08200000 40019800 16028006 00080000 80080400 00081008 00204010 02000120 11c12010 02002201 00000020 18200f00 01008080 81580018 00203401 80000400 00404200 90000000 04000202 80060003 04000000 00822e10 |